What is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-C(CH3)2-CH3?
Practice Questions
1 question
Q1
What is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-C(CH3)2-CH3?
3,3-dimethylpentane
2,2-dimethylhexane
2-methylhexane
3-methylpentane
The longest chain has five carbons (pentane) with two methyl groups on the third carbon, making it 3,3-dimethylpentane.
Questions & Step-by-step Solutions
1 item
Q
Q: What is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-C(CH3)2-CH3?
Solution: The longest chain has five carbons (pentane) with two methyl groups on the third carbon, making it 3,3-dimethylpentane.
Steps: 5
Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
Step 2: In the given structure, the longest chain has 5 carbon atoms, which is called pentane.
Step 3: Look for any branches (substituents) attached to the main chain. In this case, there are two methyl groups (CH3) attached to the third carbon of the main chain.
Step 4: Since there are two methyl groups on the third carbon, we use the prefix 'dimethyl' to indicate this.
Step 5: Combine the information: the longest chain is pentane, and there are two methyl groups on the third carbon, resulting in the name 3,3-dimethylpentane.
