What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH
Practice Questions
Q1
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH3)-CH3?
2,3-dimethylpentane
3,3-dimethylpentane
2,4-dimethylpentane
3-methylhexane
Questions & Step-by-Step Solutions
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH3)-CH3?
Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
Step 2: In the given structure CH3-CH(CH3)-CH2-CH(CH3)-CH3, the longest chain has 5 carbon atoms.
Step 3: Number the carbon atoms in the longest chain starting from one end. This helps in identifying the positions of any branches.
Step 4: Identify any branches (substituents) attached to the main chain. In this case, there are two methyl groups (CH3) attached.
Step 5: Determine the positions of the methyl groups. The first methyl group is on the second carbon, and the second methyl group is on the third carbon.
Step 6: Combine the information to write the IUPAC name. The base name for a 5-carbon chain is 'pentane'. Since there are two methyl groups, we use 'dimethyl' to indicate their presence.
Step 7: Write the final IUPAC name as '2,3-dimethylpentane', indicating the positions of the methyl groups.