What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH

Practice Questions

Q1
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH3)-CH3?
  1. 2,3-dimethylpentane
  2. 3,3-dimethylpentane
  3. 2,4-dimethylpentane
  4. 3-methylhexane

Questions & Step-by-Step Solutions

What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH3)-CH3?
  • Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
  • Step 2: In the given structure CH3-CH(CH3)-CH2-CH(CH3)-CH3, the longest chain has 5 carbon atoms.
  • Step 3: Number the carbon atoms in the longest chain starting from one end. This helps in identifying the positions of any branches.
  • Step 4: Identify any branches (substituents) attached to the main chain. In this case, there are two methyl groups (CH3) attached.
  • Step 5: Determine the positions of the methyl groups. The first methyl group is on the second carbon, and the second methyl group is on the third carbon.
  • Step 6: Combine the information to write the IUPAC name. The base name for a 5-carbon chain is 'pentane'. Since there are two methyl groups, we use 'dimethyl' to indicate their presence.
  • Step 7: Write the final IUPAC name as '2,3-dimethylpentane', indicating the positions of the methyl groups.
No concepts available.
Soulshift Feedback ×

On a scale of 0–10, how likely are you to recommend The Soulshift Academy?

Not likely Very likely