Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-COOH.
Practice Questions
1 question
Q1
Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-COOH.
3-Methylbutanoic acid
2-Methylbutanoic acid
3,3-Dimethylbutanoic acid
2,3-Dimethylbutanoic acid
The compound has a carboxylic acid group and a total of 5 carbons with two methyl groups on the third carbon, making it 3,3-Dimethylbutanoic acid.
Questions & Step-by-step Solutions
1 item
Q
Q: Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-COOH.
Solution: The compound has a carboxylic acid group and a total of 5 carbons with two methyl groups on the third carbon, making it 3,3-Dimethylbutanoic acid.
Steps: 5
Step 1: Identify the longest carbon chain in the compound. The structure CH3-CH(CH3)-C(CH3)2-COOH has a total of 5 carbon atoms in a straight chain.
Step 2: Determine the functional group present. The -COOH group indicates that this compound is a carboxylic acid.
Step 3: Number the carbon chain starting from the end closest to the carboxylic acid group. This gives us the following numbering: 1 (COOH), 2 (C), 3 (C), 4 (C), 5 (C).
Step 4: Identify the substituents on the carbon chain. There are two methyl groups (CH3) attached to the third carbon.
Step 5: Combine the information to write the IUPAC name. The longest chain is butanoic acid (4 carbons) with two methyl groups on the third carbon, making it 3,3-Dimethylbutanoic acid.
