Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3.
Practice Questions
1 question
Q1
Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3.
2,3-Dimethylpentane
3,3-Dimethylpentane
2-Methylhexane
3-Methylhexane
The longest chain has 5 carbons, and there are two methyl groups on the third carbon, making it 3,3-Dimethylpentane.
Questions & Step-by-step Solutions
1 item
Q
Q: Identify the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3.
Solution: The longest chain has 5 carbons, and there are two methyl groups on the third carbon, making it 3,3-Dimethylpentane.
Steps: 6
Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
Step 2: In the given structure CH3-CH(CH3)-C(CH3)2-CH2-CH3, the longest chain has 5 carbon atoms, which is called pentane.
Step 3: Look for any branches (substituents) on the main chain. In this case, there are two methyl groups (CH3) attached to the third carbon of the main chain.
Step 4: Number the carbon atoms in the main chain starting from the end closest to the first branch. This gives the third carbon the number 3.
Step 5: Since there are two methyl groups on the third carbon, we use the prefix 'Dimethyl' to indicate this.
Step 6: Combine the information: the longest chain is pentane, and there are two methyl groups on the third carbon, resulting in the name 3,3-Dimethylpentane.
