What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-C
Practice Questions
Q1
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?
2,3-Dimethylpentane
3,3-Dimethylpentane
2,2-Dimethylpentane
3-Methylpentane
Questions & Step-by-Step Solutions
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?
Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
Step 2: In the given structure, the longest chain has 5 carbon atoms, which is called 'pentane'.
Step 3: Look for any branches (methyl groups) attached to the main chain. In this case, there are two methyl groups attached to the third carbon.
Step 4: Since there are two methyl groups on the same carbon, we use the prefix 'di-' to indicate this. Therefore, we write '3,3-Dimethyl' to show the position and number of the methyl groups.
Step 5: Combine the information from Steps 2 and 4 to form the complete IUPAC name: '3,3-Dimethylpentane'.
