What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?

Practice Questions

1 question
Q1
What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?
  1. 2,3-Dimethylpentane
  2. 3,3-Dimethylpentane
  3. 2,2-Dimethylpentane
  4. 3-Methylpentane

Questions & Step-by-step Solutions

1 item
Q
Q: What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?
Solution: The longest chain has 5 carbons, with two methyl groups on the third carbon, so the name is 3,3-Dimethylpentane.
Steps: 5

Related Questions

Soulshift Feedback ×

On a scale of 0–10, how likely are you to recommend The Soulshift Academy?

Not likely Very likely