What is the IUPAC name of the compound with the structure CH3-CH(CH3)-C(CH3)2-CH

What is the IUPAC name of the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?

What is the IUPAC name of the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?

Step 1: Identify the longest continuous chain of carbon atoms in the structure. Count the number of carbon atoms in this chain.
Step 2: In the given structure, the longest chain has 5 carbon atoms, which is called 'pentane'.
Step 3: Look for any branches (methyl groups) attached to the main chain. In this case, there are two methyl groups attached to the third carbon.
Step 4: Since there are two methyl groups on the third carbon, we use the prefix 'Dimethyl' to indicate this.
Step 5: Combine the information from Steps 2 and 4 to form the IUPAC name. The final name is '3,3-Dimethylpentane'.

No concepts available.