Search
Question: What is the effect of a -CF3 group on the reactivity of an aromatic ring in electrophilic ..
Question: What is the product of the reaction of phenol with acetic anhydride?Options: Phenyl acetat..
Question: Which of the following compounds is a strong activating group for electrophilic aromatic s..
Question: What is the stereochemical outcome of the electrophilic substitution of 1,2-dimethylbenzen..
Question: Which of the following reactions involves a Friedel-Crafts acylation?Options: Benzene + CH..
Question: What is the IUPAC name of the compound with the formula C6H5-CO-CH3?Options: AcetophenoneB..
Question: Which of the following is a property of alkanes?Options: They are polarThey are soluble in..
Question: What is the molecular formula of benzene?Options: C6H6C6H12C6H10C6H8Correct Answer: C6H6So..
Question: Which of the following compounds is an example of an alkane?Options: C2H4C3H6C4H10C2H2Corr..
Question: What type of isomerism is exhibited by disubstituted benzene derivatives?Options: Geometri..
Question: Which of the following is a derivative of benzene?Options: EthyleneAcetylenePhenolPropylen..
Question: What is the main product of the hydrogenation of benzene?Options: CyclohexaneToluenePhenol..
Question: Which reagent can be used to distinguish between an alkyne and an alkene?Options: Bromine ..
Question: What is the major product of the reaction of 2-butyne with H2 in the presence of a catalys..
Question: Which of the following alkynes is the most stable?Options: 1-butyne2-butyne1-pentyne3-pent..
Question: What is the hybridization of the carbon atoms in an alkyne?Options: spsp2sp3dsp3Correct An..
Question: Which of the following is a characteristic property of alkynes?Options: Higher boiling poi..
Question: What is the product of the reaction between 1-butyne and HBr?Options: 1-bromobutane2-bromo..
Question: Which of the following reactions can be used to convert an alkyne to an alkene?Options: Hy..
Question: Which of the following reactions is not typical for alkenes?Options: Addition of H2Additio..
Question: What type of isomerism is shown by 1-Butene and 2-Butene?Options: Structural isomerismGeom..
Question: Which of the following alkenes is the most stable?Options: 1-Butene2-ButeneCyclohexeneIsob..
Question: What is the major product of the hydration of propene?Options: Propan-1-olPropan-2-olButan..
Question: Which reagent is used to test for the presence of alkenes?Options: Bromine waterPotassium ..
Question: What is the structural formula of 2-methylpropane?Options: CH3-CH2-CH(CH3)-CH3CH3-CH(CH3)-..
Question: Which alkane is used as a fuel in lighters?Options: MethaneEthaneButanePropaneCorrect Answ..
Question: How many isomers does C4H10 have?Options: 1234Correct Answer: 2Solution: C4H10 has 2 struc..
Question: Which of the following is a branched alkane?Options: PentaneIsopentaneHexaneHeptaneCorrect..
Question: What is the IUPAC name of the alkane with the formula C5H12?Options: PentaneButaneHexanePr..
Question: Which of the following is a property of aromatic hydrocarbons?Options: They are always sat..
