Search
Question: What is the effect of electron-withdrawing groups on the basicity of amines?Options: Incre..
Question: Which of the following compounds is a primary amine?Options: CH3NH2(CH3)2NH(CH3)3NC6H5NH2C..
Question: What is the hybridization of the nitrogen atom in an amine?Options: spsp2sp3sp3dCorrect An..
Question: Which of the following amines is the most basic?Options: MethylamineEthylamineAnilineDimet..
Question: What is the product of the reaction between an amine and an acyl chloride?Options: AmideEs..
Question: Which of the following is the correct order of basicity for the given amines?Options: RNH2..
Question: What is the main difference between aldehydes and ketones?Options: Position of the carbony..
Question: Which of the following is a method to prepare aldehydes?Options: Hydration of alkynesHydro..
Question: Which of the following compounds can be reduced to an alcohol?Options: AldehydeKetoneBoth ..
Question: What is the IUPAC name of CH3COCH3?Options: PropanalButan-2-oneAcetoneEthyl methyl ketoneC..
Question: Which of the following is the functional group of aldehydes?Options: -CHO-CO--C=O-OHCorrec..
Question: What type of reaction occurs when phenol is treated with sodium hydroxide?Options: Neutral..
Question: Which reagent is used to convert alcohols to alkyl halides?Options: SOCl2NaOHH2SO4KMnO4Cor..
Question: Which of the following ethers is commonly used as an anesthetic?Options: Diethyl etherMeth..
Question: What is the IUPAC name of CH3CH2CH2OH?Options: Propan-1-olButan-1-olPentanolButanolCorrect..
Question: Which of the following is a characteristic reaction of alcohols?Options: NitrationEsterifi..
Question: Which of the following s-block elements is most reactive?Options: LithiumSodiumPotassiumRu..
Question: Which of the following is a property of alkali metals?Options: They are good conductors of..
Question: Which of the following is the heaviest alkali metal?Options: LithiumSodiumPotassiumCesiumC..
Question: Which of the following elements has the smallest atomic radius?Options: SodiumChlorineArgo..
Question: Which of the following elements has the largest first ionization energy?Options: LithiumBe..
Question: Which of the following p-block elements is known for forming stable +3 oxidation state?Opt..
Question: What is the main product of the electrolysis of water?Options: Hydrogen gasOxygen gasHydro..
Question: Which of the following is a characteristic of hydrogen bonds?Options: They are stronger th..
Question: Which of the following is not a hydrogen compound?Options: H2ONH3CH4CO2Correct Answer: CO2..
Question: What is the oxidation state of hydrogen in metal hydrides?Options: +10-1+2Correct Answer: ..
Question: Which of the following is a property of hydrogen chloride (HCl)?Options: It is a gas at ro..
Question: Which of the following compounds is a strong reducing agent?Options: H2OH2SHClH2Correct An..
Question: Which of the following is a consequence of global warming?Options: Rising sea levelsIncrea..
Question: What is the main cause of the depletion of the ozone layer?Options: Carbon dioxide emissio..
