Search
Question: What is the main product when benzene reacts with chlorine in the presence of FeCl3?Option..
Question: What is the primary effect of a -CN group on a benzene ring?Options: +M effect-M effect+I ..
Question: Which of the following is a strong -M group?Options: -OCH3-NO2-CH3-FCorrect Answer: -NO2So..
Question: What is the effect of a -COOH group on the stability of a benzene ring?Options: Stabilizin..
Question: What is the product of the ozonolysis of 1-pentene?Options: PentanalAcetaldehydeButan-2-on..
Question: What type of isomerism is exhibited by alkenes?Options: Structural isomerismGeometric isom..
Question: Which of the following reactions can be used to convert an alkene into an alcohol?Options:..
Question: What is the primary goal of traffic calming measures?Options: To increase traffic speedTo ..
Question: What is the main advantage of using recycled materials in pavement construction?Options: L..
Question: Which factor is NOT typically considered in highway capacity analysis?Options: Lane widthT..
Question: What is the primary purpose of a roundabout?Options: To increase traffic speedTo reduce ve..
Question: In transportation planning, what does the term \'level of service\' (LOS) refer to?Options..
Question: What is the primary function of traffic signs?Options: To provide entertainmentTo inform a..
Question: Which geometric design element is crucial for ensuring safe sight distance?Options: Lane w..
Question: What is the design speed in highway design?Options: The maximum speed limitThe speed at wh..
Question: Which pavement material is known for its durability and resistance to deformation?Options:..
Question: What is the primary purpose of traffic signals?Options: To control vehicle speedTo manage ..
Question: Which alkane is used as a refrigerant?Options: MethaneEthanePropaneButaneCorrect Answer: P..
Question: What is the main source of alkanes?Options: CoalNatural gasPetroleumBiomassCorrect Answer:..
Question: Which of the following reactions is characteristic of alkanes?Options: Electrophilic subst..
Question: What is the structural formula of propane?Options: C3H8C2H6C4H10C5H12Correct Answer: C3H8S..
Question: What type of bonding is present in alkanes?Options: Ionic bondingCovalent bondingMetallic ..
Question: Which of the following is the simplest alkane?Options: MethaneEthanePropaneButaneCorrect A..
Question: Which of the following is a characteristic of saturated hydrocarbons?Options: They contain..
Question: Which of the following hydrocarbons is a cyclic compound?Options: ButeneCyclobutaneHexaneO..
Question: Which of the following is the correct formula for ethyne?Options: C2H2C2H4C2H6C2H8Correct ..
Question: What is the hybridization of the carbon atoms involved in the double bond of alkenes?Optio..
Question: What is the IUPAC name of CH2=CH-CH2-CH3?Options: 1-Butene2-ButenePropeneButyneCorrect Ans..
Question: What is the structural formula for 2-methylpropane?Options: CH3-CH2-CH(CH3)-CH3CH3-CH(CH3)..
Question: What is the IUPAC name for the compound with the formula C3H8?Options: PropenePropanePropy..
