Search
Question: Which of the following is a common analgesic? (2021)Options: IbuprofenAspirinParacetamolAl..
Question: Which of the following is a synthetic dye used in food? (2023)Options: CurcuminTartrazineB..
Question: Which of the following compounds is used as an antiseptic? (2020)Options: EthanolAcetic ac..
Question: The force on a charged particle moving in a magnetic field is maximum when the angle betwe..
Question: Which of the following materials is considered ferromagnetic? (2022)Options: CopperAluminu..
Question: A solenoid produces a magnetic field similar to that of a bar magnet. What is the primary ..
Question: What is the direction of the magnetic field around a straight conductor carrying current? ..
Question: If the magnetic field strength is doubled, what happens to the force on a current-carrying..
Question: Which reaction is used to prepare carboxylic acids from alcohols? (2020)Options: Oxidation..
Question: What type of biomolecule are enzymes? (2019)Options: CarbohydratesProteinsLipidsNucleic ac..
Question: Which reagent is used to convert an amine to an amide? (2023)Options: Acid chlorideAlcohol..
Question: Which of the following is a tertiary amine? (2022)Options: CH3NH2C2H5NH2N(CH3)3C6H5NH2Corr..
Question: Which of the following compounds can be prepared by the reduction of nitrobenzene? (2022)O..
Question: If the volume of a gas is doubled at constant temperature, what happens to its pressure?Op..
Question: What is the temperature in Celsius if the temperature in Kelvin is 273 K?Options: 0°C100°C..
Question: What is the work done on a gas when it is compressed from 4 L to 2 L at a constant pressur..
Question: A 2 kg block of ice at 0°C is converted to water at 0°C. How much heat is absorbed if the ..
Question: What is the efficiency of a Carnot engine operating between a hot reservoir at 600 K and a..
Question: If 500 J of heat is added to a system and 200 J of work is done by the system, what is the..
Question: Which of the following statements is true about phenols? (2023)Options: They are stronger ..
Question: Which reagent is used to convert an alcohol into an alkyl halide? (2022)Options: PCl5NaBH4..
Question: What is the significance of version control in model deployment?Options: To track changes ..
Question: What is the role of containerization in model deployment?Options: To improve model accurac..
Question: Which of the following is NOT a deployment strategy?Options: Blue-green deploymentCanary d..
Question: What is a common challenge faced during model deployment?Options: Overfitting the modelDat..
Question: What is the purpose of monitoring a deployed machine learning model?Options: To ensure the..
Question: Which tool is commonly used for deploying machine learning models as APIs?Options: TensorF..
Question: What does A/B testing involve in the context of model deployment?Options: Comparing two ve..
Question: What is a key consideration when deploying a machine learning model?Options: Model accurac..
Question: Which of the following is a common method for deploying machine learning models?Options: B..
