Search
Question: What is the IUPAC name for the polymer formed from the monomer 1,3-butadiene?Options: Poly..
Question: Which of the following is a characteristic of condensation polymerization?Options: It prod..
Question: Which of the following is the correct IUPAC name for CH3-CH2-CH2-CH(OH)-CH3?Options: 2-Pen..
Question: Which of the following compounds is a secondary alcohol?Options: 1-Butanol2-Butanol3-Penta..
Question: Which of the following is a functional group characteristic of phenols?Options: AldehydeHy..
Question: What is the correct IUPAC name for the compound CH3-CH2-CH(CH3)-OH?Options: 2-Propanol1-Bu..
Question: What is the IUPAC name of the compound with the formula C4H10O that has a branched structu..
Question: What is the main difference between cis and trans isomers?Options: Position of functional ..
Question: Which functional group is responsible for the chirality in amino acids?Options: Carboxyl g..
Question: What type of isomerism is exhibited by D-glucose and L-glucose?Options: Structural isomeri..
Question: Which of the following compounds is a structural isomer of C4H10?Options: 2-methylpropaneb..
Question: What is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-C(CH3)2..
Question: How many stereoisomers does 1,2-dichloropropane have?Options: 1234Correct Answer: 2Solutio..
Question: What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH3?Options..
Question: What is the relationship between (R)-2-butanol and (S)-2-butanol?Options: They are identic..
Question: How many stereoisomers can 2,3-dimethylbutane have?Options: 24816Correct Answer: 2Solution..
Question: What is the IUPAC name for the compound with the structure CH3-CH(CH3)-CH2-CH(CH3)-CH3?Opt..
Question: Which of the following compounds has the highest number of stereoisomers?Options: 2-butano..
Question: What is the maximum number of stereoisomers for a compound with two chiral centers?Options..
Question: What is the correct IUPAC name for the compound with the structure CH3-CH2-CH(CH3)-CH2-CH3..
Question: Which functional group is present in the compound CH3-CO-CH2-COOH?Options: AlcoholAldehyde..
Question: What is the correct IUPAC name for the compound CH3-CH2-CH(CH3)-COOH?Options: 3-methylbuta..
Question: Which of the following compounds is an example of a racemic mixture?Options: Lactic acid2-..
Question: What is the IUPAC name of the compound with the formula CH3-CH(CH3)-CH2-CHO?Options: 3-met..
Question: Which of the following compounds is a meso compound?Options: 2,3-butanediol2-butanol3-pent..
Question: What is the correct IUPAC name for the compound CH3-CH(CH3)-CH2-CH3?Options: 2-methylbutan..
Question: Which of the following is a chiral molecule?Options: 2-butanol1-butanolbutanepropeneCorrec..
Question: What is the stereochemical configuration of (R)-2-butanol?Options: SRZECorrect Answer: RSo..
Question: Which functional group is present in amino acids?Options: Carboxyl groupHydroxyl groupCarb..
Question: Which of the following compounds can exhibit cis-trans isomerism?Options: 1-hexeneCyclohex..