Search
Question: What is the IUPAC name for the compound with the formula C4H9Cl?Options: 1-Chlorobutane2-C..
Question: What is the IUPAC name for the compound C2H5-CHO?Options: EthanalPropanoic acidAcetaldehyd..
Question: Which of the following is the correct IUPAC name for the compound with the structure CH3-C..
Question: What is the IUPAC name for the compound CH3-CH(CH3)-CH2-CH3?Options: 2-Methylbutane3-Methy..
Question: What is the IUPAC name for the compound with the formula C3H7OH?Options: Propan-1-olPropan..
Question: Which of the following is the correct IUPAC name for C6H5-CH2-CH2-COOH?Options: Phenylbuta..
Question: What is the IUPAC name of CH3-CH2-CH2-COOH?Options: Butanoic acidPropanoic acidPentanoic a..
Question: Which of the following is a characteristic of optical isomers?Options: They have the same ..
Question: Which of the following compounds can exhibit both structural and geometric isomerism?Optio..
Question: Which type of isomerism is exhibited by 1,2-dichloroethene?Options: Structural isomerismGe..
Question: Which of the following statements about isomers is true?Options: Isomers have different mo..
Question: Which of the following is an example of cis-trans isomerism?Options: 1-pentene2-pentene3-p..
Question: Which of the following compounds does NOT exhibit optical isomerism?Options: Lactic acidTa..
Question: Which of the following pairs of compounds are enantiomers?Options: D-Glucose and L-Glucose..
Question: What type of isomerism is shown by compounds with the same molecular formula but different..
Question: Which of the following compounds exhibits geometric isomerism?Options: 1-butene2-butenebut..
Question: Which of the following statements is true regarding the inductive effect?Options: It is a ..
Question: Which of the following compounds is most affected by the mesomeric effect?Options: Ethylbe..
Question: What is the effect of the +M effect on the stability of a carbocation?Options: Destabilize..
Question: Which of the following is an example of a -I effect?Options: –F–OCH3–CH3–C2H5Correct Answe..
Question: In which of the following compounds does the inductive effect play a significant role?Opti..
Question: Which of the following groups is a strong +M (mesomeric) director?Options: –NO2–OH–COOH–CN..
Question: Which of the following statements about mesomeric effect is true?Options: It involves only..
Question: Which of the following groups exhibits a strong -I effect?Options: –NO2–CH3–OH–NH2Correct ..
Question: What is the primary effect of the inductive effect in organic molecules?Options: Stabiliza..
Question: What is the main product of the dehydration of ethanol?Options: EthyleneAcetaldehydeEthane..
Question: Which of the following is a primary amine?Options: CH3NH2(CH3)2NH(C2H5)3NC6H5NH2Correct An..
Question: What is the product of the reaction between an alcohol and a carboxylic acid?Options: Este..
Question: Which reagent is commonly used to test for the presence of unsaturation in organic compoun..
Question: What type of isomerism is shown by butanol and isobutanol?Options: GeometricStructuralOpti..
