Search
Question: What type of polymerization involves the formation of a polymer from monomers with the eli..
Question: What is the IUPAC name for the compound with the formula C3H6?Options: PropeneCyclopropane..
Question: Which of the following is the correct IUPAC name for the compound CH3-CH2-CH2-CHO?Options:..
Question: What is the IUPAC name for the compound with the formula C4H10O?Options: ButanolButanalEth..
Question: What is the IUPAC name of the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?Opti..
Question: What is the IUPAC name for the compound with the formula C6H12?Options: HexaneCyclohexane1..
Question: Which of the following compounds can exhibit tautomeric isomerism?Options: AcetoneEthanolA..
Question: Which of the following compounds does NOT exhibit isomerism?Options: C2H4C3H6C4H8C5H10Corr..
Question: Which of the following is an example of optical isomerism?Options: Lactic acidButaneCycloh..
Question: Which of the following pairs of compounds are geometric isomers?Options: Cis-2-butene and ..
Question: What type of isomerism is shown by 1-butanol and 2-butanol?Options: Geometric isomerismStr..
Question: Which of the following compounds is an example of structural isomerism?Options: C2H6C3H8C4..
Question: Which of the following is a strong +I effect group?Options: -F-Cl-Br-CH3Correct Answer: -C..
Question: Which of the following groups is a weak -I effect?Options: -CH3-Cl-Br-ICorrect Answer: -CH..
Question: What is the primary effect of the -COOH group on a benzene ring?Options: +M effect-M effec..
Question: Which of the following groups has both +M and -I effects?Options: -NH2-NO2-COOH-FCorrect A..
Question: Which substituent is a strong +M director?Options: -CHO-NO2-OH-BrCorrect Answer: -OHSoluti..
Question: Which of the following is a characteristic of the +I effect?Options: Electron donationElec..
Question: What is the effect of a -NO2 group on the stability of a benzene ring?Options: Stabilizing..
Question: Identify the group that shows a -I effect.Options: -NH2-CH3-F-OCH3Correct Answer: -FSoluti..
Question: Which of the following groups exhibits a strong +M effect?Options: -NO2-OH-CN-COOHCorrect ..
Question: What is the effect of a -CF3 group on the reactivity of an aromatic ring in electrophilic ..
Question: What is the product of the reaction of phenol with acetic anhydride?Options: Phenyl acetat..
Question: Which of the following compounds is a strong activating group for electrophilic aromatic s..
Question: What is the stereochemical outcome of the electrophilic substitution of 1,2-dimethylbenzen..
Question: Which of the following reactions involves a Friedel-Crafts acylation?Options: Benzene + CH..
Question: What is the IUPAC name of the compound with the formula C6H5-CO-CH3?Options: AcetophenoneB..
Question: Which of the following is a property of alkanes?Options: They are polarThey are soluble in..
Question: What is the molecular formula of benzene?Options: C6H6C6H12C6H10C6H8Correct Answer: C6H6So..
Question: Which of the following compounds is an example of an alkane?Options: C2H4C3H6C4H10C2H2Corr..