Search
Question: What is the principal quantum number of the outermost electron in potassium (K)?Options: 3..
Question: Which of the following quantum numbers cannot be negative?Options: Principal quantum numbe..
Question: What is the hybridization of the central atom in the complex [Ni(CO)4]?Options: spsp2sp3d2..
Question: What is the IUPAC name of the compound with the formula [Co(NH3)5Cl]Cl2?Options: Pentaammi..
Question: What is the oxidation state of iron in the complex [Fe(CN)6]3-?Options: +2+3+4+1Correct An..
Question: If the solubility product (Ksp) of AgCl is 1.77 x 10^-10, what is the molar solubility of ..
Question: In a reaction, if the rate constant doubles when the temperature increases by 10°C, what i..
Question: For the reaction 2A ⇌ B + C, if the initial concentration of A is 0.5 M and at equilibrium..
Question: What is the value of the equilibrium constant Kc for the reaction A + B ⇌ C + D at 25°C if..
Question: What type of complex is formed when a metal ion is surrounded by four ligands in a square ..
Question: Which of the following coordination numbers is NOT possible according to Werner\'s theory?..
Question: What is the significance of the \'secondary valence\' in Werner\'s theory?Options: It dete..
Question: Which of the following ligands would be classified as a bidentate ligand according to Wern..
Question: In Werner\'s theory, what does the term \'primary valence\' refer to?Options: The oxidatio..
Question: What type of isomerism is commonly observed in coordination compounds according to Werner\..
Question: Which of the following is a characteristic of Werner complexes?Options: They can only form..
Question: According to Werner\'s theory, what is the coordination number of a complex with six ligan..
Question: What is the main advantage of using polymers in manufacturing?Options: High melting pointL..
Question: What is the process called when a polymer is formed by the addition of monomers without th..
Question: What is the primary bond type in polymers?Options: Ionic bondsCovalent bondsMetallic bonds..
Question: What is the IUPAC name for the compound with the structure CH3-CH2-CH=CH2?Options: 1-Buten..
Question: Which of the following is the correct IUPAC name for the compound with the formula C4H10?O..
Question: What is the IUPAC name for the compound C2H5OH?Options: EthanolEthyleneEthaneAcetaldehydeC..
Question: What is the IUPAC name for the compound with the structure CH3-CH(CH3)-C(CH3)2-CH2-CH3?Opt..
Question: In the context of chemical kinetics, what does the term \'activation energy\' refer to?Opt..
Question: What is the IUPAC name for the compound with the formula CH3-CH2-CH(CH3)-CH2-CH3?Options: ..
Question: Which of the following compounds can show tautomeric isomerism?Options: AcetoneEthanolAcet..
Question: What type of isomerism is exhibited by 1-butanol and 2-butanol?Options: Geometric isomeris..
Question: Which molecule exhibits resonance due to hybridization?Options: C6H6C2H2CH4C2H4Correct Ans..
Question: What is the IUPAC name of CH3-CH=CH-CH2-CH3?Options: 1-Pentene2-Pentene3-PenteneButeneCorr..