Search
Question: Which reagent is used to convert an amine to an amide? (2023)Options: Acid chlorideAlcohol..
Question: Which of the following is a tertiary amine? (2022)Options: CH3NH2C2H5NH2N(CH3)3C6H5NH2Corr..
Question: Which of the following compounds can be prepared by the reduction of nitrobenzene? (2022)O..
Question: If the volume of a gas is doubled at constant temperature, what happens to its pressure?Op..
Question: What is the temperature in Celsius if the temperature in Kelvin is 273 K?Options: 0°C100°C..
Question: What is the work done on a gas when it is compressed from 4 L to 2 L at a constant pressur..
Question: A 2 kg block of ice at 0°C is converted to water at 0°C. How much heat is absorbed if the ..
Question: What is the efficiency of a Carnot engine operating between a hot reservoir at 600 K and a..
Question: If 500 J of heat is added to a system and 200 J of work is done by the system, what is the..
Question: Which of the following statements is true about phenols? (2023)Options: They are stronger ..
Question: Which reagent is used to convert an alcohol into an alkyl halide? (2022)Options: PCl5NaBH4..
Question: What is the significance of version control in model deployment?Options: To track changes ..
Question: What is the role of containerization in model deployment?Options: To improve model accurac..
Question: Which of the following is NOT a deployment strategy?Options: Blue-green deploymentCanary d..
Question: What is a common challenge faced during model deployment?Options: Overfitting the modelDat..
Question: What is the purpose of monitoring a deployed machine learning model?Options: To ensure the..
Question: Which tool is commonly used for deploying machine learning models as APIs?Options: TensorF..
Question: What does A/B testing involve in the context of model deployment?Options: Comparing two ve..
Question: What is a key consideration when deploying a machine learning model?Options: Model accurac..
Question: Which of the following is a common method for deploying machine learning models?Options: B..
Question: What is model deployment in the context of machine learning?Options: Training a model on a..
Question: If two charges +Q and -Q are placed at a distance \'d\' apart, what is the electric field ..
Question: Which of the following compounds contains a coordinate bond? (2023)Options: NH3H2OCONaClCo..
Question: What is the primary use of sulfuric acid (H2SO4) in industry? (2019)Options: Fertilizer pr..
Question: Which of the following elements is known for forming a stable +4 oxidation state? (2023)Op..
Question: Which of the following oxides is amphoteric? (2019)Options: Na2OMgOAl2O3SiO2Correct Answer..
Question: What is the main method of hydrogen production in the laboratory? (2020)Options: Electroly..
Question: Which of the following compounds contains hydrogen in a negative oxidation state? (2021)Op..
Question: What is the main product when hydrogen reacts with oxygen? (2019)Options: WaterHydrogen pe..
Question: A circuit has a total resistance of 12Ω and a current of 1.5A. What is the voltage across ..