Search
Question: What is the maximum number of electrons that can be accommodated in the p subshell? (2023)..
Question: In a thin film of oil on water, which color will appear at the center of the pattern if th..
Question: If the wavelength of light used in a double-slit experiment is increased, what happens to ..
Question: A beam of light passes through a narrow slit and produces a diffraction pattern. What is t..
Question: Which of the following compounds contains a carboxylic acid functional group? (2021)Option..
Question: What type of bond is present in alkynes? (2022)Options: Single bondDouble bondTriple bondQ..
Question: Which of the following is a cyclic hydrocarbon? (2019)Options: CyclohexaneHexaneOctaneDeca..
Question: What type of reaction occurs when 1-chloropropane reacts with potassium cyanide? (2019)Opt..
Question: Which of the following haloalkanes can undergo elimination reaction to form an alkene? (20..
Question: What is the product of the reaction between 1-bromobutane and sodium ethoxide in ethanol? ..
Question: A sound wave travels at a speed of 340 m/s and has a frequency of 1700 Hz. What is its wav..
Question: What is the frequency of a tuning fork that vibrates 256 times in 2 seconds? (2019)Options..
Question: What is the effect of heavy metals in the environment? (2023)Options: Nutrient enrichmentT..
Question: Which of the following is a method to reduce carbon footprint? (2020)Options: Using fossil..
Question: What is the role of nitrogen oxides in the environment? (2021)Options: Ozone formationGree..
Question: What is the main environmental concern associated with plastic waste? (2022)Options: Air p..
Question: Which of the following is a type of carbohydrate that is not digestible by humans? (2019)O..
Question: Which of the following is a common emulsifier used in food products? (2022)Options: Lecith..
Question: Which of the following is a common analgesic? (2021)Options: IbuprofenAspirinParacetamolAl..
Question: Which of the following is a synthetic dye used in food? (2023)Options: CurcuminTartrazineB..
Question: Which of the following compounds is used as an antiseptic? (2020)Options: EthanolAcetic ac..
Question: The force on a charged particle moving in a magnetic field is maximum when the angle betwe..
Question: Which of the following materials is considered ferromagnetic? (2022)Options: CopperAluminu..
Question: A solenoid produces a magnetic field similar to that of a bar magnet. What is the primary ..
Question: What is the direction of the magnetic field around a straight conductor carrying current? ..
Question: If the magnetic field strength is doubled, what happens to the force on a current-carrying..
Question: Which reaction is used to prepare carboxylic acids from alcohols? (2020)Options: Oxidation..
Question: What type of biomolecule are enzymes? (2019)Options: CarbohydratesProteinsLipidsNucleic ac..
Question: Which reagent is used to convert an amine to an amide? (2023)Options: Acid chlorideAlcohol..
Question: Which of the following is a tertiary amine? (2022)Options: CH3NH2C2H5NH2N(CH3)3C6H5NH2Corr..
